C9H19N3O3Si — CID 67387818
triethoxy(1,2,4-triazol-4-ylmethyl)silane (PubChem CID 67387818) has the molecular formula C9H19N3O3Si and a molecular weight of 245.35 g/mol. Its IUPAC name is triethoxy(1,2,4-triazol-4-ylmethyl)silane.
| Compound Name | triethoxy(1,2,4-triazol-4-ylmethyl)silane |
|---|---|
| PubChem CID | 67387818 |
| Molecular Formula | C9H19N3O3Si |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | triethoxy(1,2,4-triazol-4-ylmethyl)silane |
| SMILES | CCO[Si](Cn1cnnc1)(OCC)OCC |
| InChI | InChI=1S/C9H19N3O3Si/c1-4-13-16(14-5-2,15-6-3)9-12-7-10-11-8-12/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | IWCUMRUKQFKLIA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|