C38H41N9 — CID 67388671
4-(4-tert-butylphenyl)-3,5-bis[4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]-1,2,4-triazole (PubChem CID 67388671) has the molecular formula C38H41N9 and a molecular weight of 623.81 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-3,5-bis[4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]-1,2,4-triazole.
| Compound Name | 4-(4-tert-butylphenyl)-3,5-bis[4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 67388671 |
| Molecular Formula | C38H41N9 |
| Molecular Weight | 623.81 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | 4-(4-tert-butylphenyl)-3,5-bis[4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]-1,2,4-triazole |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccc(-c4cnc([C@@H]5CCCN5)[nH]4)cc3)nnc2-c2ccc(-c3cnc([C@@H]4CCCN4)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C38H41N9/c1-38(2,3)28-16-18-29(19-17-28)47-36(26-12-8-24(9-13-26)32-22-41-34(43-32)30-6-4-20-39-30)45-46-37(47)27-14-10-25(11-15-27)33-23-42-35(44-33)31-7-5-21-40-31/h8-19,22-23,30-31,39-40H,4-7,20-21H2,1-3H3,(H,41,43)(H,42,44)/t30-,31-/m0/s1 |
| InChIKey | WHNXEQUVOXIAFW-CONSDPRKSA-N |
| XLogP | 7.53 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.81 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |