C26H37N5O4 — CID 67388748
4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)benzamide (PubChem CID 67388748) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)benzamide.
| Compound Name | 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 67388748 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3nc(C(C)(C)C)no3)CC2)ccc1C(=O)NC1CCNC1=O |
| InChI | InChI=1S/C26H37N5O4/c1-17-16-19(7-8-20(17)22(32)28-21-9-12-27-23(21)33)34-15-5-6-18-10-13-31(14-11-18)25-29-24(30-35-25)26(2,3)4/h7-8,16,18,21H,5-6,9-15H2,1-4H3,(H,27,33)(H,28,32) |
| InChIKey | BEJPDAWZNQMGSD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|