C15H25N — CID 67389294
8-[(1E)-cycloocten-1-yl]-2,3,4,5,6,7-hexahydroazocine (PubChem CID 67389294) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 8-[(1E)-cycloocten-1-yl]-2,3,4,5,6,7-hexahydroazocine.
| Compound Name | 8-[(1E)-cycloocten-1-yl]-2,3,4,5,6,7-hexahydroazocine |
|---|---|
| PubChem CID | 67389294 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 8-[(1E)-cycloocten-1-yl]-2,3,4,5,6,7-hexahydroazocine |
| SMILES | C1=C(C2=N/CCCCCC/2)\CCCCCC/1 |
| InChI | InChI=1S/C15H25N/c1-2-6-10-14(11-7-3-1)15-12-8-4-5-9-13-16-15/h10H,1-9,11-13H2/b14-10+,16-15+ |
| InChIKey | LBUUCCPITQFJRG-MQIHADEYSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |