C15H24BrN5 — CID 67389320
N-(6-bromo-8-ethyl-4-methyl-7H-pyrido[2,3-d]pyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 67389320) has the molecular formula C15H24BrN5 and a molecular weight of 354.30 g/mol. Its IUPAC name is N-(6-bromo-8-ethyl-4-methyl-7H-pyrido[2,3-d]pyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(6-bromo-8-ethyl-4-methyl-7H-pyrido[2,3-d]pyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 67389320 |
| Molecular Formula | C15H24BrN5 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(6-bromo-8-ethyl-4-methyl-7H-pyrido[2,3-d]pyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCN1CC(Br)=Cc2c(C)nc(NCCCN(C)C)nc21 |
| InChI | InChI=1S/C15H24BrN5/c1-5-21-10-12(16)9-13-11(2)18-15(19-14(13)21)17-7-6-8-20(3)4/h9H,5-8,10H2,1-4H3,(H,17,18,19) |
| InChIKey | WABBQGKUVNGVOX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|