About (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride
(1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride (PubChem CID 67389496) has the molecular formula C13H20ClN
and a molecular weight of 225.76 g/mol. Its IUPAC name is (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride |
| PubChem CID | 67389496 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride |
| SMILES | CC[C@]1(C)Cc2ccccc2[C@]1(C)N.Cl |
| InChI | InChI=1S/C13H19N.ClH/c1-4-12(2)9-10-7-5-6-8-11(10)13(12,3)14;/h5-8H,4,9,14H2,1-3H3;1H/t12-,13+;/m1./s1 |
| InChIKey | HGCONZPIJURUBR-KZCZEQIWSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride?
The IUPAC name of (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride (CID 67389496) is (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride.
What is the SMILES notation for (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride?
The canonical SMILES for (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride is CC[C@]1(C)Cc2ccccc2[C@]1(C)N.Cl.
What is the InChIKey of (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride?
The InChIKey is HGCONZPIJURUBR-KZCZEQIWSA-N. The full InChI is InChI=1S/C13H19N.ClH/c1-4-12(2)9-10-7-5-6-8-11(10)13(12,3)14;/h5-8H,4,9,14H2,1-3H3;1H/t12-,13+;/m1./s1.
What are the key properties of (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride?
(1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride has a molecular weight of 225.76 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-ethyl-1,2-dimethyl-3H-inden-1-amine;hydrochloride is sourced from PubChem (CID 67389496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).