C23H25N9O2 — CID 67389562
4-[8-[[6-[(1S,4S)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]amino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide (PubChem CID 67389562) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-[8-[[6-[(1S,4S)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]amino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide.
| Compound Name | 4-[8-[[6-[(1S,4S)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]amino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 67389562 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[8-[[6-[(1S,4S)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]amino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
| SMILES | CC(C)N1C[C@@H]2C[C@H]1CN2c1ccc(Nc2ncc(-c3coc(C(N)=O)c3)n3ncnc23)cn1 |
| InChI | InChI=1S/C23H25N9O2/c1-13(2)30-9-17-6-16(30)10-31(17)20-4-3-15(7-25-20)29-22-23-27-12-28-32(23)18(8-26-22)14-5-19(21(24)33)34-11-14/h3-5,7-8,11-13,16-17H,6,9-10H2,1-2H3,(H2,24,33)(H,26,29)/t16-,17-/m0/s1 |
| InChIKey | GLPWPJGFDUOPBI-IRXDYDNUSA-N |
| XLogP | 2.29 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |