C18H17F2N3O3 — CID 67389622
(5R,6S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one (PubChem CID 67389622) has the molecular formula C18H17F2N3O3 and a molecular weight of 361.35 g/mol. Its IUPAC name is (5R,6S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one.
| Compound Name | (5R,6S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 67389622 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (5R,6S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one |
| SMILES | O=C1CC[C@@H]([N+](=O)[O-])[C@H](c2cc(F)ccc2F)N1CCc1ccccn1 |
| InChI | InChI=1S/C18H17F2N3O3/c19-12-4-5-15(20)14(11-12)18-16(23(25)26)6-7-17(24)22(18)10-8-13-3-1-2-9-21-13/h1-5,9,11,16,18H,6-8,10H2/t16-,18+/m1/s1 |
| InChIKey | JXDBXWKWLWCQRL-AEFFLSMTSA-N |
| XLogP | 2.91 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|