C14H26O2 — CID 67390139
trans-(3R,6R)-1-[(Z)-3-hydroxybut-1-enyl]-2,2,3,6-tetramethylcyclohexan-1-ol (PubChem CID 67390139) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is trans-(3R,6R)-1-[(Z)-3-hydroxybut-1-enyl]-2,2,3,6-tetramethylcyclohexan-1-ol.
| Compound Name | trans-(3R,6R)-1-[(Z)-3-hydroxybut-1-enyl]-2,2,3,6-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 67390139 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | trans-(3R,6R)-1-[(Z)-3-hydroxybut-1-enyl]-2,2,3,6-tetramethylcyclohexan-1-ol |
| SMILES | CC(O)/C=C\C1(O)[C@H](C)CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C14H26O2/c1-10-6-7-11(2)14(16,13(10,4)5)9-8-12(3)15/h8-12,15-16H,6-7H2,1-5H3/b9-8-/t10-,11-,12?,14?/m1/s1 |
| InChIKey | KNGBEGXIHFLTCC-CEQJZABXSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|