C26H35FN6O3Si — CID 67390274
tert-butyl 3-(cyanomethyl)-3-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidine-1-carboxylate (PubChem CID 67390274) has the molecular formula C26H35FN6O3Si and a molecular weight of 526.69 g/mol. Its IUPAC name is tert-butyl 3-(cyanomethyl)-3-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(cyanomethyl)-3-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67390274 |
| Molecular Formula | C26H35FN6O3Si |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | tert-butyl 3-(cyanomethyl)-3-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CC#N)(n2cc(-c3c(F)cnc4c3ccn4COCC[Si](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C26H35FN6O3Si/c1-25(2,3)36-24(34)32-16-26(17-32,8-9-28)33-15-19(13-30-33)22-20-7-10-31(23(20)29-14-21(22)27)18-35-11-12-37(4,5)6/h7,10,13-15H,8,11-12,16-18H2,1-6H3 |
| InChIKey | XHUSVPHGRQBJEV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 98.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|