C19H21FN2O4 — CID 67390336
(E)-but-2-enedioic acid;(1R)-1-(3-fluorophenyl)-2-methyl-2-pyridin-2-ylpropan-1-amine (PubChem CID 67390336) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1R)-1-(3-fluorophenyl)-2-methyl-2-pyridin-2-ylpropan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;(1R)-1-(3-fluorophenyl)-2-methyl-2-pyridin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 67390336 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-but-2-enedioic acid;(1R)-1-(3-fluorophenyl)-2-methyl-2-pyridin-2-ylpropan-1-amine |
| SMILES | CC(C)(c1ccccn1)[C@H](N)c1cccc(F)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H17FN2.C4H4O4/c1-15(2,13-8-3-4-9-18-13)14(17)11-6-5-7-12(16)10-11;5-3(6)1-2-4(7)8/h3-10,14H,17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-;/m1./s1 |
| InChIKey | IMFYGXNQBXJCAN-WZGZYPNHSA-N |
| XLogP | 2.91 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|