C16H22N6O2 — CID 67390542
N-(methoxymethyl)-1-(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)pyrazole-4-carboxamide (PubChem CID 67390542) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-(methoxymethyl)-1-(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)pyrazole-4-carboxamide.
| Compound Name | N-(methoxymethyl)-1-(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 67390542 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-(methoxymethyl)-1-(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)pyrazole-4-carboxamide |
| SMILES | COCNC(=O)c1cnn(-c2ncc(C)c(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C16H22N6O2/c1-12-8-17-16(20-14(12)21-6-4-3-5-7-21)22-10-13(9-19-22)15(23)18-11-24-2/h8-10H,3-7,11H2,1-2H3,(H,18,23) |
| InChIKey | WDBJGABBGQQQSP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|