C22H24FNO6 — CID 67390804
tert-butyl 7-ethoxy-9-[(4-fluorophenyl)methylidene]-1,2,8-trioxo-4-azaspiro[2.6]nonane-4-carboxylate (PubChem CID 67390804) has the molecular formula C22H24FNO6 and a molecular weight of 417.43 g/mol. Its IUPAC name is tert-butyl 7-ethoxy-9-[(4-fluorophenyl)methylidene]-1,2,8-trioxo-4-azaspiro[2.6]nonane-4-carboxylate.
| Compound Name | tert-butyl 7-ethoxy-9-[(4-fluorophenyl)methylidene]-1,2,8-trioxo-4-azaspiro[2.6]nonane-4-carboxylate |
|---|---|
| PubChem CID | 67390804 |
| Molecular Formula | C22H24FNO6 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | tert-butyl 7-ethoxy-9-[(4-fluorophenyl)methylidene]-1,2,8-trioxo-4-azaspiro[2.6]nonane-4-carboxylate |
| SMILES | CCOC1CCN(C(=O)OC(C)(C)C)C2(C(=O)C2=O)C(=Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H24FNO6/c1-5-29-16-10-11-24(20(28)30-21(2,3)4)22(18(26)19(22)27)15(17(16)25)12-13-6-8-14(23)9-7-13/h6-9,12,16H,5,10-11H2,1-4H3 |
| InChIKey | LCARHUXXLFTIMB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|