C26H37N7OSi — CID 67391064
2-[1-piperidin-4-yl-3-[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 67391064) has the molecular formula C26H37N7OSi and a molecular weight of 491.72 g/mol. Its IUPAC name is 2-[1-piperidin-4-yl-3-[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-piperidin-4-yl-3-[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 67391064 |
| Molecular Formula | C26H37N7OSi |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[1-piperidin-4-yl-3-[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CCNCC5)C4)c3)ccnc21 |
| InChI | InChI=1S/C26H37N7OSi/c1-35(2,3)15-14-34-20-31-13-7-24-23(6-12-29-25(24)31)21-16-30-33(17-21)26(8-9-27)18-32(19-26)22-4-10-28-11-5-22/h6-7,12-13,16-17,22,28H,4-5,8,10-11,14-15,18-20H2,1-3H3 |
| InChIKey | GASQTVYWGHAILR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|