C33H41FN8O2Si — CID 67391151
2-[1-[1-(3-fluorobenzoyl)-2-methylpiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 67391151) has the molecular formula C33H41FN8O2Si and a molecular weight of 628.83 g/mol. Its IUPAC name is 2-[1-[1-(3-fluorobenzoyl)-2-methylpiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-[1-(3-fluorobenzoyl)-2-methylpiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 67391151 |
| Molecular Formula | C33H41FN8O2Si |
| Molecular Weight | 628.83 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 2-[1-[1-(3-fluorobenzoyl)-2-methylpiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CC1CC(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)CCN1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C33H41FN8O2Si/c1-24-16-28(8-13-41(24)32(43)25-6-5-7-27(34)17-25)40-20-33(21-40,10-11-35)42-19-26(18-38-42)30-29-9-12-39(31(29)37-22-36-30)23-44-14-15-45(2,3)4/h5-7,9,12,17-19,22,24,28H,8,10,13-16,20-21,23H2,1-4H3 |
| InChIKey | CYFGYUXRXWUJRZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 105.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|