About ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate
ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate (PubChem CID 67391509) has the molecular formula C21H20FNO4
and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate |
| PubChem CID | 67391509 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC=Cc2ccccc2F)c2c(c1=O)C(=O)CCC2 |
| InChI | InChI=1S/C21H20FNO4/c1-2-27-21(26)15-13-23(12-6-8-14-7-3-4-9-16(14)22)17-10-5-11-18(24)19(17)20(15)25/h3-4,6-9,13H,2,5,10-12H2,1H3 |
| InChIKey | CRKBFTZQMJGYJD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The IUPAC name of ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate (CID 67391509) is ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate.
What is the SMILES notation for ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The canonical SMILES for ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate is CCOC(=O)c1cn(CC=Cc2ccccc2F)c2c(c1=O)C(=O)CCC2.
What is the InChIKey of ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The InChIKey is CRKBFTZQMJGYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FNO4/c1-2-27-21(26)15-13-23(12-6-8-14-7-3-4-9-16(14)22)17-10-5-11-18(24)19(17)20(15)25/h3-4,6-9,13H,2,5,10-12H2,1H3.
What are the key properties of ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate has a molecular weight of 369.39 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3-(2-fluorophenyl)prop-2-enyl]-4,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate is sourced from PubChem (CID 67391509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).