About 5-methoxy-1,3-benzothiazole-4,7-dione
5-methoxy-1,3-benzothiazole-4,7-dione (PubChem CID 67392986) has the molecular formula C8H5NO3S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-methoxy-1,3-benzothiazole-4,7-dione.
Molecular Properties
| Compound Name | 5-methoxy-1,3-benzothiazole-4,7-dione |
| PubChem CID | 67392986 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 5-methoxy-1,3-benzothiazole-4,7-dione |
| SMILES | COC1=CC(=O)c2scnc2C1=O |
| InChI | InChI=1S/C8H5NO3S/c1-12-5-2-4(10)8-6(7(5)11)9-3-13-8/h2-3H,1H3 |
| InChIKey | KWJGGVLAUQYZSH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,3-benzothiazole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,3-benzothiazole-4,7-dione?
The IUPAC name of 5-methoxy-1,3-benzothiazole-4,7-dione (CID 67392986) is 5-methoxy-1,3-benzothiazole-4,7-dione.
What is the SMILES notation for 5-methoxy-1,3-benzothiazole-4,7-dione?
The canonical SMILES for 5-methoxy-1,3-benzothiazole-4,7-dione is COC1=CC(=O)c2scnc2C1=O.
What is the InChIKey of 5-methoxy-1,3-benzothiazole-4,7-dione?
The InChIKey is KWJGGVLAUQYZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3S/c1-12-5-2-4(10)8-6(7(5)11)9-3-13-8/h2-3H,1H3.
What are the key properties of 5-methoxy-1,3-benzothiazole-4,7-dione?
5-methoxy-1,3-benzothiazole-4,7-dione has a molecular weight of 195.20 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,3-benzothiazole-4,7-dione is sourced from PubChem (CID 67392986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).