C24H32N4O — CID 67393740
3-(4-methoxy-2-methylphenyl)-2-methyl-N-pentyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-amine (PubChem CID 67393740) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-(4-methoxy-2-methylphenyl)-2-methyl-N-pentyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-amine.
| Compound Name | 3-(4-methoxy-2-methylphenyl)-2-methyl-N-pentyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-amine |
|---|---|
| PubChem CID | 67393740 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-(4-methoxy-2-methylphenyl)-2-methyl-N-pentyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-amine |
| SMILES | CCCCCNc1c2c(nc3c(-c4ccc(OC)cc4C)c(C)nn13)CCCC2 |
| InChI | InChI=1S/C24H32N4O/c1-5-6-9-14-25-23-20-10-7-8-11-21(20)26-24-22(17(3)27-28(23)24)19-13-12-18(29-4)15-16(19)2/h12-13,15,25H,5-11,14H2,1-4H3 |
| InChIKey | RAKJUDLYGWSMIF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|