About indol-2-one;1H-phenalene
indol-2-one;1H-phenalene (PubChem CID 67394127) has the molecular formula C21H15NO
and a molecular weight of 297.36 g/mol. Its IUPAC name is indol-2-one;1H-phenalene.
Molecular Properties
| Compound Name | indol-2-one;1H-phenalene |
| PubChem CID | 67394127 |
| Molecular Formula | C21H15NO |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | indol-2-one;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C13H10.C8H5NO/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;10-8-5-6-3-1-2-4-7(6)9-8/h1-8H,9H2;1-5H |
| InChIKey | ZVOAFYYFIDNKDZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indol-2-one;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-one;1H-phenalene?
The IUPAC name of indol-2-one;1H-phenalene (CID 67394127) is indol-2-one;1H-phenalene.
What is the SMILES notation for indol-2-one;1H-phenalene?
The canonical SMILES for indol-2-one;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.O=C1C=c2ccccc2=N1.
What is the InChIKey of indol-2-one;1H-phenalene?
The InChIKey is ZVOAFYYFIDNKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C8H5NO/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;10-8-5-6-3-1-2-4-7(6)9-8/h1-8H,9H2;1-5H.
What are the key properties of indol-2-one;1H-phenalene?
indol-2-one;1H-phenalene has a molecular weight of 297.36 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-one;1H-phenalene is sourced from PubChem (CID 67394127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).