C20H22FN5O4S — CID 67394223
methyl 4-[2-[1-[amino(ethyl)amino]-1-oxopropan-2-yl]oxy-4-fluoroanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 67394223) has the molecular formula C20H22FN5O4S and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 4-[2-[1-[amino(ethyl)amino]-1-oxopropan-2-yl]oxy-4-fluoroanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | methyl 4-[2-[1-[amino(ethyl)amino]-1-oxopropan-2-yl]oxy-4-fluoroanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 67394223 |
| Molecular Formula | C20H22FN5O4S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | methyl 4-[2-[1-[amino(ethyl)amino]-1-oxopropan-2-yl]oxy-4-fluoroanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCN(N)C(=O)C(C)Oc1cc(F)ccc1Nc1ncnc2sc(C(=O)OC)c(C)c12 |
| InChI | InChI=1S/C20H22FN5O4S/c1-5-26(22)19(27)11(3)30-14-8-12(21)6-7-13(14)25-17-15-10(2)16(20(28)29-4)31-18(15)24-9-23-17/h6-9,11H,5,22H2,1-4H3,(H,23,24,25) |
| InChIKey | GRWIBEHDRHOOSO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|