About methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate
methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate (PubChem CID 67394321) has the molecular formula C19H21F2NO3S
and a molecular weight of 381.44 g/mol. Its IUPAC name is methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate |
| PubChem CID | 67394321 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)cc(NC(=O)c2cc(C(C)C)c(C(C)C)s2)cc1F |
| InChI | InChI=1S/C19H21F2NO3S/c1-9(2)12-8-15(26-17(12)10(3)4)18(23)22-11-6-13(20)16(14(21)7-11)19(24)25-5/h6-10H,1-5H3,(H,22,23) |
| InChIKey | FHDCMOAWVWISDL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate?
The IUPAC name of methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate (CID 67394321) is methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate.
What is the SMILES notation for methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate?
The canonical SMILES for methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate is COC(=O)c1c(F)cc(NC(=O)c2cc(C(C)C)c(C(C)C)s2)cc1F.
What is the InChIKey of methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate?
The InChIKey is FHDCMOAWVWISDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2NO3S/c1-9(2)12-8-15(26-17(12)10(3)4)18(23)22-11-6-13(20)16(14(21)7-11)19(24)25-5/h6-10H,1-5H3,(H,22,23).
What are the key properties of methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate?
methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate has a molecular weight of 381.44 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[4,5-di(propan-2-yl)thiophene-2-carbonyl]amino]-2,6-difluorobenzoate is sourced from PubChem (CID 67394321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).