About 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride
1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride (PubChem CID 67394505) has the molecular formula C12H20ClN3O2S
and a molecular weight of 305.83 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride |
| PubChem CID | 67394505 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCNCC1)OCc1cncs1 |
| InChI | InChI=1S/C12H19N3O2S.ClH/c16-12(17-8-11-7-14-9-18-11)15-6-3-10-1-4-13-5-2-10;/h7,9-10,13H,1-6,8H2,(H,15,16);1H |
| InChIKey | LZHZBLIXHNMKKN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride?
The IUPAC name of 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride (CID 67394505) is 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride?
The canonical SMILES for 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride is Cl.O=C(NCCC1CCNCC1)OCc1cncs1.
What is the InChIKey of 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride?
The InChIKey is LZHZBLIXHNMKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S.ClH/c16-12(17-8-11-7-14-9-18-11)15-6-3-10-1-4-13-5-2-10;/h7,9-10,13H,1-6,8H2,(H,15,16);1H.
What are the key properties of 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride?
1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride has a molecular weight of 305.83 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate;hydrochloride is sourced from PubChem (CID 67394505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).