C12H14N2O4S — CID 67394565
2-methyl-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 67394565) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-methyl-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 2-methyl-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 67394565 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-methyl-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2cc(N(C)S(C)(=O)=O)ccc2c1C(N)=O |
| InChI | InChI=1S/C12H14N2O4S/c1-7-11(12(13)15)9-5-4-8(6-10(9)18-7)14(2)19(3,16)17/h4-6H,1-3H3,(H2,13,15) |
| InChIKey | OMPVMBZMSKWMPG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |