About (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone
(4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone (PubChem CID 673949) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 673949 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone |
| SMILES | Nc1nonc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C7H10N4O2/c8-6-5(9-13-10-6)7(12)11-3-1-2-4-11/h1-4H2,(H2,8,10) |
| InChIKey | RTXGOCLAZZICQK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone (CID 673949) is (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone is Nc1nonc1C(=O)N1CCCC1.
What is the InChIKey of (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is RTXGOCLAZZICQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c8-6-5(9-13-10-6)7(12)11-3-1-2-4-11/h1-4H2,(H2,8,10).
What are the key properties of (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone?
(4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 182.18 g/mol, XLogP of -0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,2,5-oxadiazol-3-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 673949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).