C18H25NO6 — CID 67395031
cyclopropylmethyl 3-amino-2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)-3-oxopropanoate (PubChem CID 67395031) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is cyclopropylmethyl 3-amino-2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)-3-oxopropanoate.
| Compound Name | cyclopropylmethyl 3-amino-2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 67395031 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | cyclopropylmethyl 3-amino-2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)-3-oxopropanoate |
| SMILES | COc1cc(C(C(N)=O)C(=O)OCC2CC2)cc(OC)c1OC(C)C |
| InChI | InChI=1S/C18H25NO6/c1-10(2)25-16-13(22-3)7-12(8-14(16)23-4)15(17(19)20)18(21)24-9-11-5-6-11/h7-8,10-11,15H,5-6,9H2,1-4H3,(H2,19,20) |
| InChIKey | NGJHKZBTBADFTQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|