About cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate
cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate (PubChem CID 67395347) has the molecular formula C18H16FN3O3S
and a molecular weight of 373.41 g/mol. Its IUPAC name is cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 67395347 |
| Molecular Formula | C18H16FN3O3S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate |
| SMILES | NC(=O)C(c1nc(C(=O)OCC2CC2)cs1)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C18H16FN3O3S/c19-10-3-4-13-11(5-10)12(6-21-13)15(16(20)23)17-22-14(8-26-17)18(24)25-7-9-1-2-9/h3-6,8-9,15,21H,1-2,7H2,(H2,20,23) |
| InChIKey | QSQQXJGOSAWZAH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate (CID 67395347) is cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate is NC(=O)C(c1nc(C(=O)OCC2CC2)cs1)c1c[nH]c2ccc(F)cc12.
What is the InChIKey of cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate?
The InChIKey is QSQQXJGOSAWZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O3S/c19-10-3-4-13-11(5-10)12(6-21-13)15(16(20)23)17-22-14(8-26-17)18(24)25-7-9-1-2-9/h3-6,8-9,15,21H,1-2,7H2,(H2,20,23).
What are the key properties of cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate?
cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate has a molecular weight of 373.41 g/mol, XLogP of 2.95, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 2-[2-amino-1-(5-fluoro-1H-indol-3-yl)-2-oxoethyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 67395347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).