About 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine
2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine (PubChem CID 67395445) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine |
| PubChem CID | 67395445 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine |
| SMILES | COc1nc2c(nc1C)OCCC2 |
| InChI | InChI=1S/C9H12N2O2/c1-6-8(12-2)11-7-4-3-5-13-9(7)10-6/h3-5H2,1-2H3 |
| InChIKey | ZELIDJKGEXLLSL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine?
The IUPAC name of 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine (CID 67395445) is 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine.
What is the SMILES notation for 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine?
The canonical SMILES for 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine is COc1nc2c(nc1C)OCCC2.
What is the InChIKey of 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine?
The InChIKey is ZELIDJKGEXLLSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-6-8(12-2)11-7-4-3-5-13-9(7)10-6/h3-5H2,1-2H3.
What are the key properties of 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine?
2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine has a molecular weight of 180.21 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-methyl-7,8-dihydro-6H-pyrano[2,3-b]pyrazine is sourced from PubChem (CID 67395445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).