About N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide
N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide (PubChem CID 67395479) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide |
| PubChem CID | 67395479 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide |
| SMILES | CN(C(=O)c1cnn(C)c1)c1cnc[nH]1 |
| InChI | InChI=1S/C9H11N5O/c1-13-5-7(3-12-13)9(15)14(2)8-4-10-6-11-8/h3-6H,1-2H3,(H,10,11) |
| InChIKey | CAYACUIMEIFIRO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide?
The IUPAC name of N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide (CID 67395479) is N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide?
The canonical SMILES for N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide is CN(C(=O)c1cnn(C)c1)c1cnc[nH]1.
What is the InChIKey of N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide?
The InChIKey is CAYACUIMEIFIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-13-5-7(3-12-13)9(15)14(2)8-4-10-6-11-8/h3-6H,1-2H3,(H,10,11).
What are the key properties of N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide?
N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide has a molecular weight of 205.22 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-5-yl)-N,1-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 67395479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).