C8H11NO6 — CID 67396600
(5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) nitrate (PubChem CID 67396600) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is (5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) nitrate.
| Compound Name | (5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) nitrate |
|---|---|
| PubChem CID | 67396600 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) nitrate |
| SMILES | COC1CC2CC(=O)OC2C1O[N+](=O)[O-] |
| InChI | InChI=1S/C8H11NO6/c1-13-5-2-4-3-6(10)14-7(4)8(5)15-9(11)12/h4-5,7-8H,2-3H2,1H3 |
| InChIKey | KYGWKZOLTDCAQN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|