C15H16O5S — CID 67396691
(2R,3R,4S,5S)-2-[4-(furan-3-yl)phenoxy]thiane-3,4,5-triol (PubChem CID 67396691) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-(furan-3-yl)phenoxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[4-(furan-3-yl)phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67396691 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-(furan-3-yl)phenoxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2ccc(-c3ccoc3)cc2)SC[C@H]1O |
| InChI | InChI=1S/C15H16O5S/c16-12-8-21-15(14(18)13(12)17)20-11-3-1-9(2-4-11)10-5-6-19-7-10/h1-7,12-18H,8H2/t12-,13+,14-,15-/m1/s1 |
| InChIKey | TVCGQEZBHCALNU-LXTVHRRPSA-N |
| XLogP | 1.48 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |