C20H28N2O2S2 — CID 67396887
2-methyl-2-[[4-[2-(4-pentylanilino)ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 67396887) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-methyl-2-[[4-[2-(4-pentylanilino)ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 2-methyl-2-[[4-[2-(4-pentylanilino)ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 67396887 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-methyl-2-[[4-[2-(4-pentylanilino)ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | CCCCCc1ccc(NCCc2csc(SC(C)(C)C(=O)O)n2)cc1 |
| InChI | InChI=1S/C20H28N2O2S2/c1-4-5-6-7-15-8-10-16(11-9-15)21-13-12-17-14-25-19(22-17)26-20(2,3)18(23)24/h8-11,14,21H,4-7,12-13H2,1-3H3,(H,23,24) |
| InChIKey | FCONZMFTPPQTPM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|