C22H23NO7S — CID 67396982
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-pyridin-3-ylphenoxy)thian-3-yl] acetate (PubChem CID 67396982) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-pyridin-3-ylphenoxy)thian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-pyridin-3-ylphenoxy)thian-3-yl] acetate |
|---|---|
| PubChem CID | 67396982 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-pyridin-3-ylphenoxy)thian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](Oc2ccc(-c3cccnc3)cc2)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H23NO7S/c1-13(24)27-19-12-31-22(21(29-15(3)26)20(19)28-14(2)25)30-18-8-6-16(7-9-18)17-5-4-10-23-11-17/h4-11,19-22H,12H2,1-3H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | BKSXBZOUPSOARX-MBDNFAEBSA-N |
| XLogP | 3.00 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|