C16H19NO4S2 — CID 67397151
(2S,3R,4S,5S)-2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenoxy]thiane-3,4,5-triol (PubChem CID 67397151) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenoxy]thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67397151 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2S,3R,4S,5S)-2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenoxy]thiane-3,4,5-triol |
| SMILES | Cc1nc(C)c(-c2cccc(O[C@H]3SC[C@@H](O)[C@H](O)[C@H]3O)c2)s1 |
| InChI | InChI=1S/C16H19NO4S2/c1-8-15(23-9(2)17-8)10-4-3-5-11(6-10)21-16-14(20)13(19)12(18)7-22-16/h3-6,12-14,16,18-20H,7H2,1-2H3/t12-,13+,14-,16+/m1/s1 |
| InChIKey | WYHMNDLYOUNIGM-CTASWTNQSA-N |
| XLogP | 1.96 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |