C16H21NO — CID 67397296
1,2,3,3a,4,5,5a,6,7,8,9,9a-dodecahydroindeno[5,4-f]quinolin-10-one (PubChem CID 67397296) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1,2,3,3a,4,5,5a,6,7,8,9,9a-dodecahydroindeno[5,4-f]quinolin-10-one.
| Compound Name | 1,2,3,3a,4,5,5a,6,7,8,9,9a-dodecahydroindeno[5,4-f]quinolin-10-one |
|---|---|
| PubChem CID | 67397296 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1,2,3,3a,4,5,5a,6,7,8,9,9a-dodecahydroindeno[5,4-f]quinolin-10-one |
| SMILES | O=C1C=C2CCCC2C2=C1C1CCCNC1CC2 |
| InChI | InChI=1S/C16H21NO/c18-15-9-10-3-1-4-11(10)12-6-7-14-13(16(12)15)5-2-8-17-14/h9,11,13-14,17H,1-8H2 |
| InChIKey | WYUFWFNKOMVFRL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |