C19H29BO5 — CID 67397305
ethyl 4-[2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate (PubChem CID 67397305) has the molecular formula C19H29BO5 and a molecular weight of 348.25 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate.
| Compound Name | ethyl 4-[2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 67397305 |
| Molecular Formula | C19H29BO5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | ethyl 4-[2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1OC |
| InChI | InChI=1S/C19H29BO5/c1-7-23-16(21)13-9-11-14-10-8-12-15(17(14)22-6)20-24-18(2,3)19(4,5)25-20/h8,10,12H,7,9,11,13H2,1-6H3 |
| InChIKey | DKFVRVMDIHGDLK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|