C19H21FN4O4S2 — CID 67397624
tert-butyl N-[[5-(2-fluoro-3-pyridinyl)-1-(1,3-thiazol-2-ylsulfonyl)pyrrol-3-yl]methyl]-N-methylcarbamate (PubChem CID 67397624) has the molecular formula C19H21FN4O4S2 and a molecular weight of 452.53 g/mol. Its IUPAC name is tert-butyl N-[[5-(2-fluoro-3-pyridinyl)-1-(1,3-thiazol-2-ylsulfonyl)pyrrol-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-(2-fluoro-3-pyridinyl)-1-(1,3-thiazol-2-ylsulfonyl)pyrrol-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67397624 |
| Molecular Formula | C19H21FN4O4S2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | tert-butyl N-[[5-(2-fluoro-3-pyridinyl)-1-(1,3-thiazol-2-ylsulfonyl)pyrrol-3-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(-c2cccnc2F)n(S(=O)(=O)c2nccs2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21FN4O4S2/c1-19(2,3)28-18(25)23(4)11-13-10-15(14-6-5-7-21-16(14)20)24(12-13)30(26,27)17-22-8-9-29-17/h5-10,12H,11H2,1-4H3 |
| InChIKey | LQSQXRGJPXDWHS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|