C18H22N2O4S — CID 67397625
(2R,3R,4S,5S)-2-[3-[6-(dimethylamino)-3-pyridinyl]phenoxy]thiane-3,4,5-triol (PubChem CID 67397625) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[3-[6-(dimethylamino)-3-pyridinyl]phenoxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[3-[6-(dimethylamino)-3-pyridinyl]phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67397625 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2R,3R,4S,5S)-2-[3-[6-(dimethylamino)-3-pyridinyl]phenoxy]thiane-3,4,5-triol |
| SMILES | CN(C)c1ccc(-c2cccc(O[C@@H]3SC[C@@H](O)[C@H](O)[C@H]3O)c2)cn1 |
| InChI | InChI=1S/C18H22N2O4S/c1-20(2)15-7-6-12(9-19-15)11-4-3-5-13(8-11)24-18-17(23)16(22)14(21)10-25-18/h3-9,14,16-18,21-23H,10H2,1-2H3/t14-,16+,17-,18-/m1/s1 |
| InChIKey | WXMQMAHYJQWVKB-BZZMCLGOSA-N |
| XLogP | 1.35 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |