About 1-Phenyltetrazol-5-thiol sodium salt
1-Phenyltetrazol-5-thiol sodium salt (PubChem CID 67399154) has the molecular formula C7H6N4NaS
and a molecular weight of 201.21 g/mol.
Molecular Properties
| Compound Name | 1-Phenyltetrazol-5-thiol sodium salt |
| PubChem CID | 67399154 |
| Molecular Formula | C7H6N4NaS |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | — |
| SMILES | S=c1nn[nH]n1-c1ccccc1.[Na] |
| InChI | InChI=1S/C7H6N4S.Na/c12-7-8-9-10-11(7)6-4-2-1-3-5-6;/h1-5H,(H,8,10,12); |
| InChIKey | IRSCLWYPLNPCQX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-Phenyltetrazol-5-thiol sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Phenyltetrazol-5-thiol sodium salt?
The IUPAC name of 1-Phenyltetrazol-5-thiol sodium salt (CID 67399154) is not available.
What is the SMILES notation for 1-Phenyltetrazol-5-thiol sodium salt?
The canonical SMILES for 1-Phenyltetrazol-5-thiol sodium salt is S=c1nn[nH]n1-c1ccccc1.[Na].
What is the InChIKey of 1-Phenyltetrazol-5-thiol sodium salt?
The InChIKey is IRSCLWYPLNPCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4S.Na/c12-7-8-9-10-11(7)6-4-2-1-3-5-6;/h1-5H,(H,8,10,12);.
What are the key properties of 1-Phenyltetrazol-5-thiol sodium salt?
1-Phenyltetrazol-5-thiol sodium salt has a molecular weight of 201.21 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Phenyltetrazol-5-thiol sodium salt is sourced from PubChem (CID 67399154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).