C16H14F3NO4S — CID 67399465
(2S,3R,4S,5S)-2-[2,3-difluoro-5-(2-fluoro-3-pyridinyl)phenoxy]thiane-3,4,5-triol (PubChem CID 67399465) has the molecular formula C16H14F3NO4S and a molecular weight of 373.35 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[2,3-difluoro-5-(2-fluoro-3-pyridinyl)phenoxy]thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[2,3-difluoro-5-(2-fluoro-3-pyridinyl)phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67399465 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2S,3R,4S,5S)-2-[2,3-difluoro-5-(2-fluoro-3-pyridinyl)phenoxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](Oc2cc(-c3cccnc3F)cc(F)c2F)SC[C@H]1O |
| InChI | InChI=1S/C16H14F3NO4S/c17-9-4-7(8-2-1-3-20-15(8)19)5-11(12(9)18)24-16-14(23)13(22)10(21)6-25-16/h1-5,10,13-14,16,21-23H,6H2/t10-,13+,14-,16+/m1/s1 |
| InChIKey | QUFUIQSARFGFKM-FTOGJNOLSA-N |
| XLogP | 1.70 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|