C22H24N2O2 — CID 67400265
3-cyclopropyl-6-[1-(4-ethylphenyl)-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one (PubChem CID 67400265) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-cyclopropyl-6-[1-(4-ethylphenyl)-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one.
| Compound Name | 3-cyclopropyl-6-[1-(4-ethylphenyl)-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67400265 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-cyclopropyl-6-[1-(4-ethylphenyl)-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
| SMILES | CCc1ccc(C(=C[C@H]2CCC(=O)N2)c2ccc(C3CC3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-14-3-5-16(6-4-14)19(13-17-9-12-21(25)23-17)20-11-10-18(15-7-8-15)22(26)24-20/h3-6,10-11,13,15,17H,2,7-9,12H2,1H3,(H,23,25)(H,24,26)/t17-/m1/s1 |
| InChIKey | KULYBDQAVSYUNV-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |