About N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine
N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine (PubChem CID 67401024) has the molecular formula C25H30ClN3O2
and a molecular weight of 439.99 g/mol. Its IUPAC name is N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine.
Molecular Properties
| Compound Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine |
| PubChem CID | 67401024 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nccc4ccccc34)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C25H30ClN3O2/c1-3-30-22-15-18(16-23(24(22)26)31-4-2)17-29-13-10-20(11-14-29)28-25-21-8-6-5-7-19(21)9-12-27-25/h5-9,12,15-16,20H,3-4,10-11,13-14,17H2,1-2H3,(H,27,28) |
| InChIKey | BWMVHGMDNVJTJV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine?
The IUPAC name of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine (CID 67401024) is N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine.
What is the SMILES notation for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine?
The canonical SMILES for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine is CCOc1cc(CN2CCC(Nc3nccc4ccccc34)CC2)cc(OCC)c1Cl.
What is the InChIKey of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine?
The InChIKey is BWMVHGMDNVJTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30ClN3O2/c1-3-30-22-15-18(16-23(24(22)26)31-4-2)17-29-13-10-20(11-14-29)28-25-21-8-6-5-7-19(21)9-12-27-25/h5-9,12,15-16,20H,3-4,10-11,13-14,17H2,1-2H3,(H,27,28).
What are the key properties of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine?
N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine has a molecular weight of 439.99 g/mol, XLogP of 5.76, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]isoquinolin-1-amine is sourced from PubChem (CID 67401024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).