About 9H-pyrido[2,1-b][1,3]benzothiazin-11-one
9H-pyrido[2,1-b][1,3]benzothiazin-11-one (PubChem CID 67401116) has the molecular formula C12H9NOS
and a molecular weight of 215.28 g/mol. Its IUPAC name is 9H-pyrido[2,1-b][1,3]benzothiazin-11-one.
Molecular Properties
| Compound Name | 9H-pyrido[2,1-b][1,3]benzothiazin-11-one |
| PubChem CID | 67401116 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 9H-pyrido[2,1-b][1,3]benzothiazin-11-one |
| SMILES | O=C1c2ccccc2SC2=CC=CCN12 |
| InChI | InChI=1S/C12H9NOS/c14-12-9-5-1-2-6-10(9)15-11-7-3-4-8-13(11)12/h1-7H,8H2 |
| InChIKey | CAEWPJRNCDLNGW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-pyrido[2,1-b][1,3]benzothiazin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrido[2,1-b][1,3]benzothiazin-11-one?
The IUPAC name of 9H-pyrido[2,1-b][1,3]benzothiazin-11-one (CID 67401116) is 9H-pyrido[2,1-b][1,3]benzothiazin-11-one.
What is the SMILES notation for 9H-pyrido[2,1-b][1,3]benzothiazin-11-one?
The canonical SMILES for 9H-pyrido[2,1-b][1,3]benzothiazin-11-one is O=C1c2ccccc2SC2=CC=CCN12.
What is the InChIKey of 9H-pyrido[2,1-b][1,3]benzothiazin-11-one?
The InChIKey is CAEWPJRNCDLNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NOS/c14-12-9-5-1-2-6-10(9)15-11-7-3-4-8-13(11)12/h1-7H,8H2.
What are the key properties of 9H-pyrido[2,1-b][1,3]benzothiazin-11-one?
9H-pyrido[2,1-b][1,3]benzothiazin-11-one has a molecular weight of 215.28 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrido[2,1-b][1,3]benzothiazin-11-one is sourced from PubChem (CID 67401116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).