C19H13ClN4O2S — CID 67401659
3-[(4-chlorobenzoyl)amino]-N-phenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide (PubChem CID 67401659) has the molecular formula C19H13ClN4O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is 3-[(4-chlorobenzoyl)amino]-N-phenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide.
| Compound Name | 3-[(4-chlorobenzoyl)amino]-N-phenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 67401659 |
| Molecular Formula | C19H13ClN4O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-[(4-chlorobenzoyl)amino]-N-phenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide |
| SMILES | O=C(Nc1[nH]nc2sc(C(=O)Nc3ccccc3)cc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN4O2S/c20-12-8-6-11(7-9-12)17(25)22-16-14-10-15(27-19(14)24-23-16)18(26)21-13-4-2-1-3-5-13/h1-10H,(H,21,26)(H2,22,23,24,25) |
| InChIKey | WUKMQYMKUAZUTE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |