About [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate
[1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate (PubChem CID 67401738) has the molecular formula C12H18F3NO3
and a molecular weight of 281.27 g/mol. Its IUPAC name is [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate.
Molecular Properties
| Compound Name | [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate |
| PubChem CID | 67401738 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate |
| SMILES | CC(=O)OC(C(F)(F)F)C1(C)CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C12H18F3NO3/c1-8(17)16-6-4-11(3,5-7-16)10(12(13,14)15)19-9(2)18/h10H,4-7H2,1-3H3 |
| InChIKey | GWNCGVGHOZQAEG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate?
The IUPAC name of [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate (CID 67401738) is [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate.
What is the SMILES notation for [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate?
The canonical SMILES for [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate is CC(=O)OC(C(F)(F)F)C1(C)CCN(C(C)=O)CC1.
What is the InChIKey of [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate?
The InChIKey is GWNCGVGHOZQAEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO3/c1-8(17)16-6-4-11(3,5-7-16)10(12(13,14)15)19-9(2)18/h10H,4-7H2,1-3H3.
What are the key properties of [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate?
[1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate has a molecular weight of 281.27 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-acetyl-4-methylpiperidin-4-yl)-2,2,2-trifluoroethyl] acetate is sourced from PubChem (CID 67401738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).