About 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid
1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid (PubChem CID 67401785) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 67401785 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCc1nc(N2CCCC2C(=O)O)cc(N)c1N |
| InChI | InChI=1S/C12H18N4O2/c1-2-8-11(14)7(13)6-10(15-8)16-5-3-4-9(16)12(17)18/h6,9H,2-5,14H2,1H3,(H2,13,15)(H,17,18) |
| InChIKey | UEUZBYKYONILNH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid (CID 67401785) is 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid is CCc1nc(N2CCCC2C(=O)O)cc(N)c1N.
What is the InChIKey of 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid?
The InChIKey is UEUZBYKYONILNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-2-8-11(14)7(13)6-10(15-8)16-5-3-4-9(16)12(17)18/h6,9H,2-5,14H2,1H3,(H2,13,15)(H,17,18).
What are the key properties of 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid?
1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid has a molecular weight of 250.30 g/mol, XLogP of 0.86, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-diamino-6-ethyl-2-pyridinyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 67401785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).