About 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide
2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide (PubChem CID 67401886) has the molecular formula C11H17N5O2S
and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide.
Molecular Properties
| Compound Name | 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide |
| PubChem CID | 67401886 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide |
| SMILES | N#Cc1c(N)cccc1N1CCCC1.NS(N)(=O)=O |
| InChI | InChI=1S/C11H13N3.H4N2O2S/c12-8-9-10(13)4-3-5-11(9)14-6-1-2-7-14;1-5(2,3)4/h3-5H,1-2,6-7,13H2;(H4,1,2,3,4) |
| InChIKey | YVKIBTCUHLEWBL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide?
The IUPAC name of 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide (CID 67401886) is 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide.
What is the SMILES notation for 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide?
The canonical SMILES for 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide is N#Cc1c(N)cccc1N1CCCC1.NS(N)(=O)=O.
What is the InChIKey of 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide?
The InChIKey is YVKIBTCUHLEWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3.H4N2O2S/c12-8-9-10(13)4-3-5-11(9)14-6-1-2-7-14;1-5(2,3)4/h3-5H,1-2,6-7,13H2;(H4,1,2,3,4).
What are the key properties of 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide?
2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide has a molecular weight of 283.36 g/mol, XLogP of -0.11, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-pyrrolidin-1-ylbenzonitrile;sulfamide is sourced from PubChem (CID 67401886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).