C7H6BrN3O2S — CID 67402187
4-bromo-2-cyano-1-(sulfamoylamino)benzene (PubChem CID 67402187) has the molecular formula C7H6BrN3O2S and a molecular weight of 276.12 g/mol. Its IUPAC name is 4-bromo-2-cyano-1-(sulfamoylamino)benzene.
| Compound Name | 4-bromo-2-cyano-1-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 67402187 |
| Molecular Formula | C7H6BrN3O2S |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 4-bromo-2-cyano-1-(sulfamoylamino)benzene |
| SMILES | N#Cc1cc(Br)ccc1NS(N)(=O)=O |
| InChI | InChI=1S/C7H6BrN3O2S/c8-6-1-2-7(5(3-6)4-9)11-14(10,12)13/h1-3,11H,(H2,10,12,13) |
| InChIKey | LRUJXSRTXOFDCC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |