About 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid
2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid (PubChem CID 67402302) has the molecular formula C31H26N2O5S
and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid.
Molecular Properties
| Compound Name | 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid |
| PubChem CID | 67402302 |
| Molecular Formula | C31H26N2O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid |
| SMILES | COC(=O)c1ccc2nc(NC(CSC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)O)oc2c1 |
| InChI | InChI=1S/C31H26N2O5S/c1-37-29(36)21-17-18-25-27(19-21)38-30(32-25)33-26(28(34)35)20-39-31(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-19,26H,20H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | FZTZPSGIXNMBQI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid?
The IUPAC name of 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid (CID 67402302) is 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid.
What is the SMILES notation for 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid?
The canonical SMILES for 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid is COC(=O)c1ccc2nc(NC(CSC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)O)oc2c1.
What is the InChIKey of 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid?
The InChIKey is FZTZPSGIXNMBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26N2O5S/c1-37-29(36)21-17-18-25-27(19-21)38-30(32-25)33-26(28(34)35)20-39-31(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-19,26H,20H2,1H3,(H,32,33)(H,34,35).
What are the key properties of 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid?
2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid has a molecular weight of 538.63 g/mol, XLogP of 6.20, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-methoxycarbonyl-1,3-benzoxazol-2-yl)amino]-3-tritylsulfanylpropanoic acid is sourced from PubChem (CID 67402302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).