C20H21F3N2O — CID 67402669
(3R)-3-[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]-1-oxa-8-azaspiro[4.5]decane (PubChem CID 67402669) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is (3R)-3-[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3-[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 67402669 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (3R)-3-[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]-1-oxa-8-azaspiro[4.5]decane |
| SMILES | FC(F)(F)c1ccc(-c2cccc([C@@H]3COC4(CCNCC4)C3)c2)nc1 |
| InChI | InChI=1S/C20H21F3N2O/c21-20(22,23)17-4-5-18(25-12-17)15-3-1-2-14(10-15)16-11-19(26-13-16)6-8-24-9-7-19/h1-5,10,12,16,24H,6-9,11,13H2/t16-/m0/s1 |
| InChIKey | HUMSSRUBTUOTHJ-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |