C11H8F3NOS — CID 67402697
2,2,2-trifluoro-1-(2-phenyl-1,3-thiazol-5-yl)ethanol (PubChem CID 67402697) has the molecular formula C11H8F3NOS and a molecular weight of 259.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-phenyl-1,3-thiazol-5-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(2-phenyl-1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 67402697 |
| Molecular Formula | C11H8F3NOS |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-phenyl-1,3-thiazol-5-yl)ethanol |
| SMILES | OC(c1cnc(-c2ccccc2)s1)C(F)(F)F |
| InChI | InChI=1S/C11H8F3NOS/c12-11(13,14)9(16)8-6-15-10(17-8)7-4-2-1-3-5-7/h1-6,9,16H |
| InChIKey | HCEHAGLFIJKHQP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |